SUNBRIGHT® OE-080CS

Description: Oleoyl-O(CH2CH2)nCO-CH2CH2-COO-NHS
PEG Mw: 8,000
CAS#:
Packaging size: 1g amber glass bottle.