SUNBRIGHT® OE-020CS

Description: Oleyl-O(CH2CH2)nCO-CH2CH2-COO-NHS
PEG Mw: 2,000
CAS#:
Packaging: 1g amber glass bottle.